Rosiglitazone maleate
API Standard
| Catalog Number | CS-O-02261 |
| Alternative Name(s) | (2Z)-but-2-ened2-yl)amino]ethoxy}phenyl)methyl]-1,3-thiazolidine-2,4-dione;Rosiglitazone maleate; Avandia; 155141-29-0; Avandaryl; Rosiglitazone (maleate); Maleic acid; rosiglitazone; |
| Research Area | Rosiglitazone maleate is an antidiabetic drug in the thiazolidinedione class of drugs. It works as an insulin sensitizer, by binding to the PPAR receptors in fat cells and making the cells more responsive to insulin. |
| Molecular Formula | C22H23N3O7S |
| CAS# | 155141-29-0 |
| Purity | >98% |
| SMILES | OC(/C=CC(O)=O)=O.O=C(N1)C(SC1=O)CC2=CC=C(OCCN(C3=CC=CC=N3)C)C=C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02261.html |