Rosuvastatin calcium
API Standard
| Catalog Number | CS-O-02229 |
| Alternative Name(s) | (3R,5S,6E)-7-[4-(4-Fluorophenyl)-6-(1-methylethyl)-2-[methyl(methylsulfonyl)amino]-5-pyrimidinyl]-3,5-dihydroxy-6-heptenoic Acid Calcium Salt |
| Research Area | Rosuvastatin Calcium is the calcium salt form of rosuvastatin, a statin with antilipidemic activity. Rosuvastatin selectively and competitively binds to and inhibits hepatic hydroxymethyl-glutaryl coenzyme A (HMG-CoA) reductase, the enzyme which catalyzes |
| Molecular Formula | C44H54CaF2N6O12S2 |
| CAS# | 147098-20-2 |
| Purity | >98% |
| SMILES | O[C@@H](C[C@@H](O)CC([O-])=O)/C=C/C(C(C1=CC=C(F)C=C1)=NC(N(C)[S](C)(=O)=O)=N2)=C2C(C)C.O[C@@H](C[C@@H](O)CC([O-])=O)/C=C/C(C(C3=CC=C(F)C=C3)=NC(N(C)[S](C)(=O)=O)=N4)=C4C(C)C.[Ca+2] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02229.html |