Quinine Hydrochloride
API Standard
| Catalog Number | CS-O-02216 |
| Alternative Name(s) | (6-methoxyquinolin-4-yl)(4-vinylquinuclidin-2-yl)methanol hydrochloride |
| Research Area | Quinine hydrochloride is an alkaloid derived from the bark of the cinchona tree. It is used as an antimalarial drug, and is the active ingredient in extracts of the cinchona that have been used for that purpose since before 1633. Quinine is also a mild an |
| Molecular Formula | C20H25ClN2O2 |
| CAS# | 130-89-2 |
| Purity | >98% |
| SMILES | O[C@@H]([C@@]1([H])[N@@](CC2)C[C@H](C=C)[C@@H]2C1)C3=CC=NC4=CC=C(OC)C=C34.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02216.html |