Norephedrine
API Standard
| Catalog Number | CS-O-02151 |
| Alternative Name(s) | (1S,2R)-2-amino-1-phenylpropan-1-ol;Phenylpropanolamine;Phenyl propanolamine;Rhiest. |
| Research Area | Norephedrine is a sympathomimetic that acts mainly by causing release of NOREPINEPHRINE but also has direct agonist activity at some adrenergic receptors. It is most commonly used as a nasal vasoconstrictor and an appetite depressant. |
| Molecular Formula | C9H13NO |
| CAS# | 14838-15-4 |
| Purity | >98% |
| SMILES | O[C@@H](C1=CC=CC=C1)[C@H](N)C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02151.html |