Oxaceprol
API Standard
| Catalog Number | CS-O-02039 |
| Alternative Name(s) | (2S,4R)-1-acetyl-4-hydroxypyrrolidine-2-carboxylic acid |
| Research Area | Oxaceprol is an anti-inflammatory drug used in the treatment of osteoarthritis. The active effect of Oxaceprol is to inhibit the adhesion and migration of white blood cells. |
| Molecular Formula | C7H11NO4 |
| CAS# | 33996-33-7 |
| Purity | >98% |
| SMILES | OC([C@H](C[C@@H](O)C1)N1C(C)=O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02039.html |