Oxybenzone
API Standard
| Catalog Number | CS-O-02030 |
| Alternative Name(s) | 2-benzoyl-5-methoxyphenol |
| Research Area | Oxybenzone is a benzophenone derivative used as a sunscreen agent. Oxybenzone absorbs UVB and UVA II rays, resulting in a photochemical excitation and absorption of energy. Upon return to ground state, the absorbed energy results in emission of longer wav |
| Molecular Formula | C14H12O3 |
| CAS# | 131-57-7 |
| Purity | >98% |
| SMILES | O=C(C1=CC=CC=C1)C(C=CC(OC)=C2)=C2O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02030.html |