Proxcinod
API Standard
| Catalog Number | CS-O-01993 |
| Alternative Name(s) | 4-(nitrooxy)butyl 2-(6-methoxynaphthalen-2-yl)propanoate |
| Research Area | Naproxcinod is a nitric oxide-releasing NSAID derivative. Naproxcinod significantly ameliorated skeletal muscle force and resistance to fatigue in sedentary as well as in exercised mice, reduced inflammatory infiltrates and fibrosis deposition in both car |
| Molecular Formula | C18H21NO6 |
| CAS# | 163133-43-5 |
| Purity | >98% |
| SMILES | C[C@@H](C1=CC2=CC=C(OC)C=C2C=C1)C(OCCCCO[N+]([O-])=O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01993.html |