Leflunomide
API Standard
| Catalog Number | CS-O-01811 |
| Alternative Name(s) | 5-Methylisoxazole-4-[4-trifluorometthyl-N-[4-(trifluoromethyl)phenyl]-4-isoxazlunomidum; |
| Research Area | An immunosuppressive. Inhibits T and B cell proliferation. Activity is attributed mainly to its metabolite, a malononitrile derivative, which is beleived to inhibit dihydroorotate dehydrogenase as well as several protein tyrosine kinases. Therapeutically as a antirheumatic (Merck Index). |
| Molecular Formula | C12H9F3N2O2 |
| CAS# | 75706-12-6 |
| Purity | >98% |
| SMILES | O=C(C(C=NO1)=C1C)NC2=CC=C(C(F)(F)F)C=C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01811.html |