Lubiprostone
API Standard
| Catalog Number | CS-O-01782 |
| Alternative Name(s) | 7-((2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oeptaubiprostone;Prostan-1-oc cid, 16,16-difluoro-11-hydroxy-9,15-dioxo-, (11α)-.7-[(2R,4aR,5R,7aR)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxo-3,4,4a,5,7,7a-hexahydrcclopenta[b]pyran-5-yl]heptanoc cid;(-)-7-((2R,4aR,5R,7aR)-2-(1,1-Difluoropentyl)-2-hydroxy-6-oxoctahydrcclopenta(b)pyran-5-yl)heptanoc cid (-)-7-[(2r,4ar,5r,7ar)-2-(1,1-difluoropentyl)-2-hydroxy-6-oxoctahydrcclopenta[b]pyran-5-yl]heptanoc cid |
| Research Area | It is a bicyclic fatty acid (prostaglandin E1 derivative) which acts by specifically activating ClC-2 chloride channels on the apical aspect of gastrointestinal epithelial cells, producing a chloride-rich fluid secretion. |
| Molecular Formula | C20H32F2O5 |
| CAS# | 136790-76-6 |
| Purity | >98% |
| SMILES | O=C(C(F)(F)CCCC)CC[C@@H]([C@@H](C1)O)[C@H](C1=O)CCCCCCC(O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01782.html |