Levosulpiride
API Standard
| Catalog Number | CS-O-01769 |
| Alternative Name(s) | N-{[(2S)-1-ethylpyrrolidin-2-yl]methyl}-2-methoxy-5-sulfamoylbenzamide |
| Research Area | Cocarboxylase is the coenzyme form of Vitamin B1 present in many animal tissues. It is a required intermediate in the PYRUVATE DEHYDROGENASE COMPLEX and the KETOGLUTARATE DEHYDROGENASE COMPLEX. |
| Molecular Formula | C15H23N3O4S |
| CAS# | 23672-07-03 |
| Purity | >98% |
| SMILES | CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCOP(=O)(O)OP(=O)(O)O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01769.html |