Ketotifen fumarate
API Standard
| Catalog Number | CS-O-01707 |
| Alternative Name(s) | 4-(1-methylpiperidin-4-ylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-10(9H)-one fumarate |
| Research Area | Ketotifen Fumarate is the fumarate salt of ketotifen, a cycloheptathiophene derivative with anti-allergic activity. Ketotifen selectively blocks histamine (H1) receptors and prevents the typical symptoms caused by histamine release. This agent also interf |
| Molecular Formula | C23H23NO5S |
| CAS# | 34580-14-8 |
| Purity | >98% |
| SMILES | OC(/C=C/C(O)=O)=O.O=C(CC1=C/2C=CC=C1)C(SC=C3)=C3C2=C4CCN(C)CC4 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01707.html |