Homatropine Hydrobromide
API Standard
| Catalog Number | CS-O-01626 |
| Alternative Name(s) | α-Hydroxybenzeneacetic Acid (3-Endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl Ester, Hydrobromide; 1αH,5αH-Tropan-3α-ol Mandelate (Ester) Hydrobromide |
| Research Area | Homatropine is an anticholinergic agent.Homatropine acts as an inhibitor of the muscarinic acetylcholine receptors. Homatropine is used in eye drops as a cycloplegic and as a mydriatic, to dilate the pupil. |
| Molecular Formula | C16H22BrNO3 |
| CAS# | 51-56-9 |
| Purity | >98% |
| SMILES | O=C(C(C1=CC=CC=C1)O)O[C@H]2C[C@@H](CC3)N(C)[C@@H]3C2.Br |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01626.html |