Decitabine
API Standard
| Catalog Number | CS-O-01351 |
| Alternative Name(s) | 4-Amino-1-(2-deoxy-β-D-erythro-pentofuranosyl)-1,3,5-triazin-2(1H)-one |
| Research Area | Decitabine is a cytidine antimetabolite analogue with potential antineoplastic activity. Decitabine incorporates into DNA and inhibits DNA methyltransferase, resulting in hypomethylation of DNA and intra-S-phase arrest of DNA replication. |
| Molecular Formula | C8H12N4O4 |
| CAS# | 2353-33-5 |
| Purity | >98% |
| SMILES | O=C1N([C@@H]2O[C@H](CO)[C@@H](O)C2)C=NC(N)=N1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01351.html |