Clopidogrel Hydrochloride
API Standard
| Catalog Number | CS-O-01126 |
| Alternative Name(s) | (+/7-dihydrothieno[3,2c]pyridine-5(4H)-cetc cid methyl ester;2-(2chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2c]pyridin-5-yl)cetc cid methyl ester;methyl 2-(2chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2c]pyridin-5-yl)cetate;methyl 2-(2chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2c]pyridin-5-yl)ethanoate;Methyl2-(4,5,6,7-tetrahydrothieno[3,2c]pyridin-5-yl)-2-(2chlorophenyl)cetatehydrchloride;Sclopidogrel hydrchloride. |
| Research Area | Clopidogrel Hydrochloride is an oral, thienopyridine-class antiplatelet agent used to inhibit blood clots in coronary artery disease, peripheral vascular disease, cerebrovascular disease, and to prevent myocardial infarction (heart attack) and stroke. |
| Molecular Formula | C16H1Cl2NO2S |
| CAS# | 120202-65-5 |
| Purity | >98% |
| SMILES | O=C(OC)[C@H](C(C=CC=C1)=C1Cl)N2CC(C=CS3)=C3CC2.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01126.html |