Clebopride maleate
API Standard
| Catalog Number | CS-O-01117 |
| Alternative Name(s) | 4-amino-N-(1-benzylpiperidin-4-yl)-5-chloro-2-methoxybenzamide maleate |
| Research Area | Clebopride is a dopamine antagonist drug with antiemetic and prokinetic properties used to treat functional gastrointestinal disorders. Chemically, it is a substituted benzamide, closely related to metoclopramide. |
| CAS# | 84370-95-6 |
| Purity | >98% |
| SMILES | OC(/C=CC(O)=O)=O.O=C(C(C=C(Cl)C(N)=C1)=C1OC)NC2CCN(CC3=CC=CC=C3)CC2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01117.html |
