Alclometasone Dipropionate
API Standard
| Catalog Number | CS-O-00891 |
| Alternative Name(s) | Aclomethasone-17,21-dipropionate |
| Research Area | Alclometasone Dipropionate is the dipropionate salt form of alclometasone, a synthetic corticosteroid with low to medium potency. Alclometasone dipropionate is a glucocorticoid receptor agonist that mimics the metabolic, anti-inflammatory, immunosuppressi |
| Molecular Formula | C28H3ClO7 |
| CAS# | 66734-13-2 |
| Purity | >98% |
| SMILES | O=C([C@]([C@]([C@@]1([H])C2)(C[C@H](O)[C@@]([C@]3(C=C4)C)([H])[C@@]1([H])[C@@H](CC3=CC4=O)Cl)C)([C@@H]2C)OC(CC)=O)COC(CC)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00891.html |