Alendronic Acid
API Standard
| Catalog Number | CS-O-00873 |
| Alternative Name(s) | sodium [4-amino-1-hydroxy-1-(hydroxy-oxido-phosphoryl)- butyl]phosphonc cid trihydrate ; sodium trihydrate hydrogen (4‐amino‐1‐hydroxy‐1‐phosphonobutyl)phosphonate |
| Research Area | Alendronic Acid is a second generation bisphosphonate and synthetic analog of pyrophosphate with anti-bone-resorption activity. Alendronic acid binds to and inhibits the activity of farnesyl pyrophosphate synthetase, an enzyme involved in terpenoid biosyn |
| Molecular Formula | C4H13NO7P2 |
| CAS# | 66376-36-1 |
| Purity | >98% |
| SMILES | OC([P](O)(O)=O)(CCCN)[P](O)(O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00873.html |