Allylestrenol
API Standard
| Catalog Number | CS-O-00815 |
| Alternative Name(s) | (8R,9S,10R,13S,14S,17R)-17-allyl-13-methyl-2,3,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| Research Area | Allylestrenol was designed to be used for miscarriage prevention, prevention of premature labour and has been investigated for possible use in men for treatment for benign prostatic hyperplasia. |
| Molecular Formula | C21H32O |
| CAS# | 432-60-0 |
| Purity | >98% |
| SMILES | C[C@@]1([C@]2(O)CC=C)[C@](CC2)([H])[C@@](CCC3=CCCC[C@]43[H])([H])[C@]4([H])CC1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00815.html |