Cabozantinib
API Standard
| Catalog Number | CS-L-00116 |
| Alternative Name(s) | N'1-{4-[(6,7-dimethoxyquinolin-4-yl)oxy]phenyl}-N1-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| Research Area | Cabozantinib is an orally bioavailable, small molecule receptor tyrosine kinase (RTK) inhibitor with potential antineoplastic activity. Cabozantinib strongly binds to and inhibits several RTKs, which are often overexpressed in a variety of cancer cell typ |
| CAS# | 849217-68-1 |
| Purity | >98% |
| SMILES | COC1=C(OC)C=C2C(OC3=CC=C(NC(=O)C4(CC4)C(=O)NC4=CC=C(F)C=C4)C=C3)=CC=NC2=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSL00116.html |
