(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic acid ethyl ester
(S)-1-Boc-2,3-dihydro-2-pyrrolecarboxylic Acid is used to prepare captopril analogs as inhibitors of angiotensin converting enzyme. It is also used to prepare stereoisomers of DPP-IV inhibitor saxagliptin.
| Catalog Number | CS-O-10632 |
| Alternative Name(s) | (S)-2,3-Dihydro-1H-pyrrole-1,2-dicarboxylic acid 1-(1,1-dimethylethyl) 2-Ethyl Ester; (S)-2,3-Dihydropyrrole-1,2-dicarboxylic Acid 1-tert-Butyl Ester 2-Ethyl Ester |
| Research Area | Intermediates |
| Molecular Formula | C12H19NO4 |
| CAS# | 178172-26-4 |
| Purity | >98% |
| SMILES | O=C(N(C=CC1)[C@@H]1C(OCC)=O)OC(C)(C)C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10632.html |