N,O-Bis(trimethylsilyl)acetamide
N,O-Bis(trimethylsilyl)acetamide is used as a reagent in the synthesis of 4'-spirocyclic phosphono-nucleosides as potential inhibitors of hepatitis C virus NS5B polymerase. Also used as a reagent in the microwave-assisted synthesis of purine nucle
| Catalog Number | CS-O-10667 |
| Alternative Name(s) | BSA; BSiA; Bis(trimethylsilyl)acetamide; Bis(trimethylsilyl)acetimidate; Dynasylan; BSA; LS 7270; N,O-Bis(trimethylsillyl)acetamide; N-(Trimethylsilyl)acetimidic Acid Trimethylsilyl Ester; N-(Trimethylsilyl)ethanimidic Acid Trimethylsilyl Ester; O,N-Bis(trimethylsilyl)acetamide |
| Research Area | Intermediates |
| Molecular Formula | C8H21NOSi2 |
| CAS# | 10416-59-8 |
| Purity | >98% |
| SMILES | C[Si](C)(C)/N=C(C)O[Si](C)(C)C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10667.html |
