Propargyl benzenesulfonate
Propargyl Benzenesulfonate is a general chemical reagent used in organic syntheses. Used in the manufacture of Omarigliptin, a DPP-4 inhibitor used in the treatment of type-2 diabetes.
| Catalog Number | CS-O-31855 |
| Alternative Name(s) | prop-2-yn-1-yl benzenesulfonate |
| Research Area | Intermediates |
| Molecular Formula | C9H8O3S |
| CAS# | 6165-75-9 |
| Purity | >98% |
| SMILES | O=[S](OCC#C)(C1=CC=CC=C1)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31855.html |
