Loperamide N-Oxide
Loperamide oxide (LOPOX) is a prodrug of Loperamide (LOP). It is concluded that Loperamide oxide administered intraluminally is reduced to Loperamide and has the same antisecretory potency as Loperamide in jejunum and colon.
| Catalog Number | CS-O-06077 |
| Alternative Name(s) | Loperamide Impurity F;trans-4-hyl-α,α-diphenyl-1-piperidinebutanamide 1-Oxide; Arestal; Loperamide Oxide; R 58425; Loperamide EP impurity G ;CS-O-14318;CS-O-13782 |
| Research Area | Metabolites |
| Molecular Formula | C29H33ClN2O3 |
| CAS# | 106900-12-3 |
| Purity | >98% |
| SMILES | O=C(N(C)C)C(C1=CC=CC=C1)(C2=CC=CC=C2)CC[N]3(CCC(O)(C4=CC=C(Cl)C=C4)CC3)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06077.html |