Calcitriol
The biologically active form of Vitamin D3. Calcium regulator; vitamin (antirachitic); antihyperparathyroid; antineoplastic; antipsoriatic.
| Catalog Number | CS-O-06153 |
| Alternative Name(s) | 1,25-DihydroxyVitaminD3;1 alpha, 25 dihydroxy 20 epi Vitamin D3;(1R,3S,5Z)-4-Methylene-5-[(2E)-2-[(1R,3aS,7aSmethylhexyl]-7a-methyl-4H-inden-4-ylidene]ethylidene]-1diol; (1a,3β,5Z,7E)- 9,10-Sccholesta-5,7,10(19)-triene-1,3,25-triol,;1 α, 25 dihydroxy 20 epi Vitamin D3 |
| Research Area | Metabolites |
| Molecular Formula | C27H44O3 |
| CAS# | 32222-06-03 |
| Purity | >98% |
| SMILES | C[C@]([C@@]1([H])[C@H](C)CCCC(C)(O)C)(CCC/2)[C@](CC1)([H])C2=CC=C(C[C@@H](O)C[C@@H]3O)/C3=C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06153.html |
