6-Aminohexanoic Acid Trimer
6-(6-(6-Aminohexanamido)hexanamido)hexanoic Acid is used in the making of a preconjugate which serves as immunoreactive conjugate useful as a developer antigen in a competitive inhibition immunoassay for the polymorphic analyte. Also used in the efficient synthesis of a heterobifunctional coupling agent.
| Catalog Number | CS-T-62887 |
| Alternative Name(s) | 6-[6-(6-aminohexanamido)hexanamido]hexanoic acid |
| Molecular Formula | C18H35N3O4 |
| CAS# | 5776-78-3 |
| Purity | >98% |
| SMILES | O=C(NCCCCCC(O)=O)CCCCCNC(CCCCCN)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST62887.html |