Diazepam impurity A
5-Chloro-2-(methylamino)benzophenone is an impurity of 1,4- Temazepam as well as a decompoition product of Diazepam and other 1,4-benzodiazepine derivatives. ;Impurity in commercial preparations of Benzophenone
| Catalog Number | CS-T-11926 |
| Alternative Name(s) | Diazepam impurity A;Amino Chloro Benzophenone impurity standard;Temazepam Impurity A;5-Chloro-2-(methylamino) benzophenone ;5-Chloro-2-(methylamino)benzophenone; Benzophenone Impurity.;(5-chloro-2-(methylamino)phenyl)(phenyl)methanone |
| Molecular Formula | C14H12ClNO |
| CAS# | 1022-13-5 |
| Purity | >98% |
| SMILES | O=C(C1=CC=CC=C1)C(C=C(Cl)C=C2)=C2NC |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST11926.html |