Des [3-(1-Dimethylamino)ethyl] 3-Acetyl Rivastigmine
Des [3-(1-dimethylamino)ethyl] 3-acetyl Rivastigmine is a derivative of Rivastigmine (Tartrate), and acetylcholinesterase inhibitor that is commonly used to treat dementia associated with Parkinson's disease and Alzheimer's disease. ;Impurity in commercial preparations of Rivastigmine
| Catalog Number | CS-T-15870 |
| Alternative Name(s) | Rivastigmine Impurity-D;N-Ethyl-N-metr |
| CAS# | 855300-09-3 |
| Purity | >98% |
| SMILES | O=C(N(C)CC)OC1=CC(C(C)=O)=CC=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST15870.html |