Bortezomib 1R, 2R Isomer
(1R,2R)-Bortezomib is a diastereomer of Bortezomib (B675700), the first proteasome inhibitor to be approved by the US FDA for multiple myeloma, a blood cancer. A reversible inhibitor of the 26S proteasome-a barrel-shaped multiprotein particle found in the nucleus and cytosol of all eukaryotic cells. Targets the ubiquitin-proteasome pathway
| Catalog Number | CS-O-31035 |
| Alternative Name(s) | Bortezomib 1R, 2R Isomer;[(1R)-3-methyl-1-[(2R)-3-phenyl-2-(pyrazin-2-ylformamido)propanamido]butyl]boronic acid;B-[(1R)-3-Methyl-1-[[(2R)-1-oxo-3-phenyl-2-[(2-pyrazinylcarbonyl)amino]propyl]amino]butyl]boronic Acid; [(1R)-3-Methyl-1-[[(2R)-1-oxo-3-phenyl-2-[(pyrazinylcarbonyl)amino]propyl]amino]butyl]boronic Acid |
| Molecular Formula | C19H25BN4O4 |
| CAS# | 1132709-15-9 |
| Purity | >98% |
| SMILES | O=C(N[C@H](B(O)O)CC(C)C)[C@H](NC(C1=NC=CN=C1)=O)CC2=CC=CC=C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31035.html |