Es-Zopiclone
Eszopiclone is the active stereoizomer of Zopiclone and belongs to the class of drug known as cyclopyrrones. It is a nonbenzodiazepine hypnotic agent used as a treatment for insomnia. This is a controlled substance (depressant) in the US but not in Canada
| Catalog Number | CS-O-00230 |
| Alternative Name(s) | (S)-Zopiclone;(5S)-6-H-pyrrolo[3,4-b]pyrazin-5-yl 4-methylpiperazine-1-carboxylate;(S)-(+)-6-(5-Chloro-2-pyridinyl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5-yl-4-methyl-1-piperazinecarboxylate |
| Molecular Formula | C17H17ClN6O3 |
| CAS# | 138729-47-2 |
| Purity | >98% |
| SMILES | O=C(N1CCN(C)CC1)O[C@@H](C2=NC=CN=C23)N(C4=CC=C(Cl)C=N4)C3=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00230.html |
