Duloxetine EP Impurity F
Impurity in commercial preparations of Duloxetine. An isomeric impurity of the antidepressant Duloxetine.
| Catalog Number | CS-O-20019 |
| Alternative Name(s) | Duloxetine EP Impurity F;DULOXETINE HCL IMPURITY III;Duloxetine Impurity D;1104890-90-5 ;(3S)-N-Methyl-3-(naphthalen-1-yloxy)-3-(thiophen-3-yl)propan-1-amine oxalate;xalate; N-Methyl-γ-(1-naphthalenyloxy)-3-thiophenepropanamine Ethanedioate;phthalen-1-yloxy)-3-(thiophen-3-yl)propan-1-amine Oxalate; Duloxetine Impurity D; CS-T-21458 ; Duloxetine EP Impurity G |
| Molecular Formula | C18H19NOS |
| CAS# | 959392-22-4 |
| Purity | >98% |
| SMILES | CNCC[C@@H](C1=CSC=C1)OC2=CC=CC3=C2C=CC=C3 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO20019.html |
