Selexipag Impurity B
5,6-Diphenylpyrazinol is a diphenylpyrazine derivative which belongs to a class of prostacyclin receptor agonists. It is impurity of Selexipag that is a potential drug for the treatment of various vascular disorders such as pulmonary arterial hypertension and arteriosclerosis obliterans.
| Catalog Number | CS-T-88920 |
| Alternative Name(s) | Selexipag Hydroxy Impurity; 5,6-Diphenyl-2(1H)-pyrazinone; 2-Hydroxy-5,6-diphenylpyrazine; 5,6-Diphenyl-2-hydroxypyrazine; 5,6-Diphenylpyrazinol; |
| Molecular Formula | C16H12N2O |
| CAS# | 18591-57-6 |
| Purity | >98% |
| SMILES | OC1=NC(C2=CC=CC=C2)=C(C3=CC=CC=C3)N=C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST88920.html |
