(-)-Dimethyl 2,3-O-benzylidene-L-tartrate

Catalog Number ACM38270723
Alternative Name(s) (R,R)-(-)-DIMETHYL 2,3-O-BENZYLIDENE-L-TARTRATE;(-)-DIMETHYL 2,3-O-BENZYLIDENE-L-TARTRATE;DIMETHYL 2,3-O-BENZYLIDENE-L-TARTRATE;DIMETHYL (4R,5R)-2-PHENYL-1,3-DIOXOLANE-4,5-DICARBOXYLATE;(-)-2,3-O-BENZYLIDENE-L-TARTARIC ACID DIMETHYL ESTER;2,3(-)-O-BENZYL
Molecular Formula C13H14O6
CAS# 38270-72-3
Purity >96%
SMILES COC(=O)C1C(OC(O1)C2=CC=CC=C2)C(=O)OC
Size inquire
Supplier Page https://www.alfa-chemistry.com/cas_38270-72-3.htm